C10H10N8 — CID 174354464
9-[(4R)-4-azidocyclopent-2-en-1-yl]purin-6-amine (PubChem CID 174354464) has the molecular formula C10H10N8 and a molecular weight of 242.25 g/mol. Its IUPAC name is 9-[(4R)-4-azidocyclopent-2-en-1-yl]purin-6-amine.
| Compound Name | 9-[(4R)-4-azidocyclopent-2-en-1-yl]purin-6-amine |
|---|---|
| PubChem CID | 174354464 |
| Molecular Formula | C10H10N8 |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 9-[(4R)-4-azidocyclopent-2-en-1-yl]purin-6-amine |
| SMILES | [N-]=[N+]=N[C@H]1C=CC(n2cnc3c(N)ncnc32)C1 |
| InChI | InChI=1S/C10H10N8/c11-9-8-10(14-4-13-9)18(5-15-8)7-2-1-6(3-7)16-17-12/h1-2,4-7H,3H2,(H2,11,13,14)/t6-,7?/m0/s1 |
| InChIKey | HWOTVHGVVDMFGP-PKPIPKONSA-N |
| XLogP | 1.59 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|