C11H14N8O — CID 21145541
[(1R,3S,4S)-3-(6-aminopurin-9-yl)-4-azidocyclopentyl]methanol (PubChem CID 21145541) has the molecular formula C11H14N8O and a molecular weight of 274.29 g/mol. Its IUPAC name is [(1R,3S,4S)-3-(6-aminopurin-9-yl)-4-azidocyclopentyl]methanol.
| Compound Name | [(1R,3S,4S)-3-(6-aminopurin-9-yl)-4-azidocyclopentyl]methanol |
|---|---|
| PubChem CID | 21145541 |
| Molecular Formula | C11H14N8O |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | [(1R,3S,4S)-3-(6-aminopurin-9-yl)-4-azidocyclopentyl]methanol |
| SMILES | [N-]=[N+]=N[C@H]1C[C@H](CO)C[C@@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C11H14N8O/c12-10-9-11(15-4-14-10)19(5-16-9)8-2-6(3-20)1-7(8)17-18-13/h4-8,20H,1-3H2,(H2,12,14,15)/t6-,7-,8-/m0/s1 |
| InChIKey | QUQLKYBHKAOCCE-FXQIFTODSA-N |
| XLogP | 1.03 |
| TPSA | 138.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|