C10H13N5O2S — CID 23358719
5-(6-aminopurin-9-yl)-2-(hydroxymethyl)thiolan-3-ol (PubChem CID 23358719) has the molecular formula C10H13N5O2S and a molecular weight of 267.31 g/mol. Its IUPAC name is 5-(6-aminopurin-9-yl)-2-(hydroxymethyl)thiolan-3-ol.
| Compound Name | 5-(6-aminopurin-9-yl)-2-(hydroxymethyl)thiolan-3-ol |
|---|---|
| PubChem CID | 23358719 |
| Molecular Formula | C10H13N5O2S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 5-(6-aminopurin-9-yl)-2-(hydroxymethyl)thiolan-3-ol |
| SMILES | Nc1ncnc2c1ncn2C1CC(O)C(CO)S1 |
| InChI | InChI=1S/C10H13N5O2S/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(17)6(2-16)18-7/h3-7,16-17H,1-2H2,(H2,11,12,13) |
| InChIKey | KSPWPIFRZGARDG-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |