C10H13N5O2S — CID 22844868
(2R,3R,5S)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)thiolan-3-ol (PubChem CID 22844868) has the molecular formula C10H13N5O2S and a molecular weight of 267.31 g/mol. Its IUPAC name is (2R,3R,5S)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)thiolan-3-ol.
| Compound Name | (2R,3R,5S)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)thiolan-3-ol |
|---|---|
| PubChem CID | 22844868 |
| Molecular Formula | C10H13N5O2S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | (2R,3R,5S)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)thiolan-3-ol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1S[C@H](CO)C[C@H]1O |
| InChI | InChI=1S/C10H13N5O2S/c11-8-7-9(13-3-12-8)15(4-14-7)10-6(17)1-5(2-16)18-10/h3-6,10,16-17H,1-2H2,(H2,11,12,13)/t5-,6+,10+/m0/s1 |
| InChIKey | GHLJFOXCDYJZNB-BAJZRUMYSA-N |
| XLogP | -0.23 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |