C14H22N6O — CID 22985712
9-[3-[2-(dimethylamino)ethoxy]cyclopentyl]purin-6-amine (PubChem CID 22985712) has the molecular formula C14H22N6O and a molecular weight of 290.37 g/mol. Its IUPAC name is 9-[3-[2-(dimethylamino)ethoxy]cyclopentyl]purin-6-amine.
| Compound Name | 9-[3-[2-(dimethylamino)ethoxy]cyclopentyl]purin-6-amine |
|---|---|
| PubChem CID | 22985712 |
| Molecular Formula | C14H22N6O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 9-[3-[2-(dimethylamino)ethoxy]cyclopentyl]purin-6-amine |
| SMILES | CN(C)CCOC1CCC(n2cnc3c(N)ncnc32)C1 |
| InChI | InChI=1S/C14H22N6O/c1-19(2)5-6-21-11-4-3-10(7-11)20-9-18-12-13(15)16-8-17-14(12)20/h8-11H,3-7H2,1-2H3,(H2,15,16,17) |
| InChIKey | YEUNESIYYMQCLB-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |