C28H30N5O6PS2 — CID 10168129
S-[2-[[3-(6-aminopurin-9-yl)cyclopentyl]oxy-(2-benzoylsulfanylethoxy)phosphoryl]oxyethyl] benzenecarbothioate (PubChem CID 10168129) has the molecular formula C28H30N5O6PS2 and a molecular weight of 627.69 g/mol. Its IUPAC name is S-[2-[[3-(6-aminopurin-9-yl)cyclopentyl]oxy-(2-benzoylsulfanylethoxy)phosphoryl]oxyethyl] benzenecarbothioate.
| Compound Name | S-[2-[[3-(6-aminopurin-9-yl)cyclopentyl]oxy-(2-benzoylsulfanylethoxy)phosphoryl]oxyethyl] benzenecarbothioate |
|---|---|
| PubChem CID | 10168129 |
| Molecular Formula | C28H30N5O6PS2 |
| Molecular Weight | 627.69 g/mol |
| Exact Mass | 627.14 |
| IUPAC Name | S-[2-[[3-(6-aminopurin-9-yl)cyclopentyl]oxy-(2-benzoylsulfanylethoxy)phosphoryl]oxyethyl] benzenecarbothioate |
| SMILES | Nc1ncnc2c1ncn2C1CCC(OP(=O)(OCCSC(=O)c2ccccc2)OCCSC(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C28H30N5O6PS2/c29-25-24-26(31-18-30-25)33(19-32-24)22-11-12-23(17-22)39-40(36,37-13-15-41-27(34)20-7-3-1-4-8-20)38-14-16-42-28(35)21-9-5-2-6-10-21/h1-10,18-19,22-23H,11-17H2,(H2,29,30,31) |
| InChIKey | PERGTORWOSFHSR-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 148.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.69 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|