C18H19N6O5S- — CID 59848401
2-[[(1R,3S)-3-(6-aminopurin-9-yl)cyclopentyl]methoxysulfonylcarbamoyl]phenolate (PubChem CID 59848401) has the molecular formula C18H19N6O5S- and a molecular weight of 431.45 g/mol. Its IUPAC name is 2-[[(1R,3S)-3-(6-aminopurin-9-yl)cyclopentyl]methoxysulfonylcarbamoyl]phenolate.
| Compound Name | 2-[[(1R,3S)-3-(6-aminopurin-9-yl)cyclopentyl]methoxysulfonylcarbamoyl]phenolate |
|---|---|
| PubChem CID | 59848401 |
| Molecular Formula | C18H19N6O5S- |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 2-[[(1R,3S)-3-(6-aminopurin-9-yl)cyclopentyl]methoxysulfonylcarbamoyl]phenolate |
| SMILES | Nc1ncnc2c1ncn2[C@H]1CC[C@@H](COS(=O)(=O)NC(=O)c2ccccc2[O-])C1 |
| InChI | InChI=1S/C18H20N6O5S/c19-16-15-17(21-9-20-16)24(10-22-15)12-6-5-11(7-12)8-29-30(27,28)23-18(26)13-3-1-2-4-14(13)25/h1-4,9-12,25H,5-8H2,(H,23,26)(H2,19,20,21)/p-1/t11-,12+/m1/s1 |
| InChIKey | NOFLWHBOYKZDHC-NEPJUHHUSA-M |
| XLogP | 0.51 |
| TPSA | 165.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |