C16H16ClN7O6S — CID 145288584
[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl N-(2-chloropyridine-3-carbonyl)sulfamate (PubChem CID 145288584) has the molecular formula C16H16ClN7O6S and a molecular weight of 469.87 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl N-(2-chloropyridine-3-carbonyl)sulfamate.
| Compound Name | [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl N-(2-chloropyridine-3-carbonyl)sulfamate |
|---|---|
| PubChem CID | 145288584 |
| Molecular Formula | C16H16ClN7O6S |
| Molecular Weight | 469.87 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl N-(2-chloropyridine-3-carbonyl)sulfamate |
| SMILES | Nc1ncnc2c1ncn2[C@H]1C[C@H](O)[C@@H](COS(=O)(=O)NC(=O)c2cccnc2Cl)O1 |
| InChI | InChI=1S/C16H16ClN7O6S/c17-13-8(2-1-3-19-13)16(26)23-31(27,28)29-5-10-9(25)4-11(30-10)24-7-22-12-14(18)20-6-21-15(12)24/h1-3,6-7,9-11,25H,4-5H2,(H,23,26)(H2,18,20,21)/t9-,10+,11+/m0/s1 |
| InChIKey | IXIRTDDCVKJURA-HBNTYKKESA-N |
| XLogP | -0.20 |
| TPSA | 184.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.87 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|