C18H20N6O5S — CID 91095094
[(1S,3R)-3-(6-aminopurin-9-yl)cyclopentyl]methyl N-(2-hydroxybenzoyl)sulfamate (PubChem CID 91095094) has the molecular formula C18H20N6O5S and a molecular weight of 432.46 g/mol. Its IUPAC name is [(1S,3R)-3-(6-aminopurin-9-yl)cyclopentyl]methyl N-(2-hydroxybenzoyl)sulfamate.
| Compound Name | [(1S,3R)-3-(6-aminopurin-9-yl)cyclopentyl]methyl N-(2-hydroxybenzoyl)sulfamate |
|---|---|
| PubChem CID | 91095094 |
| Molecular Formula | C18H20N6O5S |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | [(1S,3R)-3-(6-aminopurin-9-yl)cyclopentyl]methyl N-(2-hydroxybenzoyl)sulfamate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1CC[C@H](COS(=O)(=O)NC(=O)c2ccccc2O)C1 |
| InChI | InChI=1S/C18H20N6O5S/c19-16-15-17(21-9-20-16)24(10-22-15)12-6-5-11(7-12)8-29-30(27,28)23-18(26)13-3-1-2-4-14(13)25/h1-4,9-12,25H,5-8H2,(H,23,26)(H2,19,20,21)/t11-,12+/m0/s1 |
| InChIKey | NOFLWHBOYKZDHC-NWDGAFQWSA-N |
| XLogP | 1.15 |
| TPSA | 162.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |