C19H22N6O8S — CID 25053208
[(2R,3S,4R,5R)-5-[6-(ethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl N-(2-hydroxybenzoyl)sulfamate (PubChem CID 25053208) has the molecular formula C19H22N6O8S and a molecular weight of 494.49 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[6-(ethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl N-(2-hydroxybenzoyl)sulfamate.
| Compound Name | [(2R,3S,4R,5R)-5-[6-(ethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl N-(2-hydroxybenzoyl)sulfamate |
|---|---|
| PubChem CID | 25053208 |
| Molecular Formula | C19H22N6O8S |
| Molecular Weight | 494.49 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[6-(ethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl N-(2-hydroxybenzoyl)sulfamate |
| SMILES | CCNc1ncnc2c1ncn2[C@@H]1O[C@H](COS(=O)(=O)NC(=O)c2ccccc2O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H22N6O8S/c1-2-20-16-13-17(22-8-21-16)25(9-23-13)19-15(28)14(27)12(33-19)7-32-34(30,31)24-18(29)10-5-3-4-6-11(10)26/h3-6,8-9,12,14-15,19,26-28H,2,7H2,1H3,(H,24,29)(H,20,21,22)/t12-,14-,15-,19-/m1/s1 |
| InChIKey | SGBSNACLEOIPBP-QEPJRFBGSA-N |
| XLogP | -0.73 |
| TPSA | 198.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.49 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |