C13H20N6O7S — CID 58296216
[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(2-methoxyethylamino)purin-9-yl]oxolan-2-yl]methyl sulfamate (PubChem CID 58296216) has the molecular formula C13H20N6O7S and a molecular weight of 404.41 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(2-methoxyethylamino)purin-9-yl]oxolan-2-yl]methyl sulfamate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(2-methoxyethylamino)purin-9-yl]oxolan-2-yl]methyl sulfamate |
|---|---|
| PubChem CID | 58296216 |
| Molecular Formula | C13H20N6O7S |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(2-methoxyethylamino)purin-9-yl]oxolan-2-yl]methyl sulfamate |
| SMILES | COCCNc1ncnc2c1ncn2[C@@H]1O[C@H](COS(N)(=O)=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H20N6O7S/c1-24-3-2-15-11-8-12(17-5-16-11)19(6-18-8)13-10(21)9(20)7(26-13)4-25-27(14,22)23/h5-7,9-10,13,20-21H,2-4H2,1H3,(H2,14,22,23)(H,15,16,17)/t7-,9-,10-,13-/m1/s1 |
| InChIKey | GXDYGOIXRRTAKV-QYVSTXNMSA-N |
| XLogP | -2.28 |
| TPSA | 183.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|