C19H23N7O7S — CID 137470714
[(2R,3S,4R,5R)-5-[6-(dimethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl N-(2-aminobenzoyl)sulfamate (PubChem CID 137470714) has the molecular formula C19H23N7O7S and a molecular weight of 493.50 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[6-(dimethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl N-(2-aminobenzoyl)sulfamate.
| Compound Name | [(2R,3S,4R,5R)-5-[6-(dimethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl N-(2-aminobenzoyl)sulfamate |
|---|---|
| PubChem CID | 137470714 |
| Molecular Formula | C19H23N7O7S |
| Molecular Weight | 493.50 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[6-(dimethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl N-(2-aminobenzoyl)sulfamate |
| SMILES | CN(C)c1ncnc2c1ncn2[C@@H]1O[C@H](COS(=O)(=O)NC(=O)c2ccccc2N)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H23N7O7S/c1-25(2)16-13-17(22-8-21-16)26(9-23-13)19-15(28)14(27)12(33-19)7-32-34(30,31)24-18(29)10-5-3-4-6-11(10)20/h3-6,8-9,12,14-15,19,27-28H,7,20H2,1-2H3,(H,24,29)/t12-,14-,15-,19-/m1/s1 |
| InChIKey | PVKWLMPTPPOSRV-QEPJRFBGSA-N |
| XLogP | -1.21 |
| TPSA | 195.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.50 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|