C28H41N7O8S — CID 25053279
[(2R,3S,4R,5R)-5-[6-(cyclopentylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl N-(2-hydroxybenzoyl)sulfamate;N,N-diethylethanamine (PubChem CID 25053279) has the molecular formula C28H41N7O8S and a molecular weight of 635.74 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[6-(cyclopentylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl N-(2-hydroxybenzoyl)sulfamate;N,N-diethylethanamine.
| Compound Name | [(2R,3S,4R,5R)-5-[6-(cyclopentylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl N-(2-hydroxybenzoyl)sulfamate;N,N-diethylethanamine |
|---|---|
| PubChem CID | 25053279 |
| Molecular Formula | C28H41N7O8S |
| Molecular Weight | 635.74 g/mol |
| Exact Mass | 635.27 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[6-(cyclopentylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl N-(2-hydroxybenzoyl)sulfamate;N,N-diethylethanamine |
| SMILES | CCN(CC)CC.O=C(NS(=O)(=O)OC[C@H]1O[C@@H](n2cnc3c(NC4CCCC4)ncnc32)[C@H](O)[C@@H]1O)c1ccccc1O |
| InChI | InChI=1S/C22H26N6O8S.C6H15N/c29-14-8-4-3-7-13(14)21(32)27-37(33,34)35-9-15-17(30)18(31)22(36-15)28-11-25-16-19(23-10-24-20(16)28)26-12-5-1-2-6-12;1-4-7(5-2)6-3/h3-4,7-8,10-12,15,17-18,22,29-31H,1-2,5-6,9H2,(H,27,32)(H,23,24,26);4-6H2,1-3H3/t15-,17-,18-,22-;/m1./s1 |
| InChIKey | JCXPQRXHEMPSIK-GIQPGJFOSA-N |
| XLogP | 1.55 |
| TPSA | 201.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.74 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |