C28H38N10O10S — CID 25156674
N,N-diethylethanamine;ethyl 1-[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[(2-hydroxybenzoyl)sulfamoyloxymethyl]oxolan-2-yl]purin-2-yl]triazole-4-carboxylate (PubChem CID 25156674) has the molecular formula C28H38N10O10S and a molecular weight of 706.74 g/mol. Its IUPAC name is N,N-diethylethanamine;ethyl 1-[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[(2-hydroxybenzoyl)sulfamoyloxymethyl]oxolan-2-yl]purin-2-yl]triazole-4-carboxylate.
| Compound Name | N,N-diethylethanamine;ethyl 1-[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[(2-hydroxybenzoyl)sulfamoyloxymethyl]oxolan-2-yl]purin-2-yl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 25156674 |
| Molecular Formula | C28H38N10O10S |
| Molecular Weight | 706.74 g/mol |
| Exact Mass | 706.25 |
| IUPAC Name | N,N-diethylethanamine;ethyl 1-[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[(2-hydroxybenzoyl)sulfamoyloxymethyl]oxolan-2-yl]purin-2-yl]triazole-4-carboxylate |
| SMILES | CCN(CC)CC.CCOC(=O)c1cn(-c2nc(N)c3ncn([C@@H]4O[C@H](COS(=O)(=O)NC(=O)c5ccccc5O)[C@@H](O)[C@H]4O)c3n2)nn1 |
| InChI | InChI=1S/C22H23N9O10S.C6H15N/c1-2-39-21(36)11-7-31(29-27-11)22-25-17(23)14-18(26-22)30(9-24-14)20-16(34)15(33)13(41-20)8-40-42(37,38)28-19(35)10-5-3-4-6-12(10)32;1-4-7(5-2)6-3/h3-7,9,13,15-16,20,32-34H,2,8H2,1H3,(H,28,35)(H2,23,25,26);4-6H2,1-3H3/t13-,15-,16-,20-;/m1./s1 |
| InChIKey | KDEVDSAEPWOWPL-IGTVFDLNSA-N |
| XLogP | -0.47 |
| TPSA | 272.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.74 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 19 |