C20H24N8O6S — CID 137470708
2-amino-N-[[(2R,3S,4R,5R)-5-[6-(cyclopropylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfamoyl]benzamide (PubChem CID 137470708) has the molecular formula C20H24N8O6S and a molecular weight of 504.53 g/mol. Its IUPAC name is 2-amino-N-[[(2R,3S,4R,5R)-5-[6-(cyclopropylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfamoyl]benzamide.
| Compound Name | 2-amino-N-[[(2R,3S,4R,5R)-5-[6-(cyclopropylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 137470708 |
| Molecular Formula | C20H24N8O6S |
| Molecular Weight | 504.53 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | 2-amino-N-[[(2R,3S,4R,5R)-5-[6-(cyclopropylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfamoyl]benzamide |
| SMILES | Nc1ccccc1C(=O)NS(=O)(=O)NC[C@H]1O[C@@H](n2cnc3c(NC4CC4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H24N8O6S/c21-12-4-2-1-3-11(12)19(31)27-35(32,33)25-7-13-15(29)16(30)20(34-13)28-9-24-14-17(26-10-5-6-10)22-8-23-18(14)28/h1-4,8-10,13,15-16,20,25,29-30H,5-7,21H2,(H,27,31)(H,22,23,26)/t13-,15-,16-,20-/m1/s1 |
| InChIKey | RFPNUBGSBQGHMJ-KHTYJDQRSA-N |
| XLogP | -1.13 |
| TPSA | 206.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.53 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|