C20H22N8O9S — CID 130383124
N-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfamoyl]-4-(2-nitrophenyl)-4-oxobutanamide (PubChem CID 130383124) has the molecular formula C20H22N8O9S and a molecular weight of 550.51 g/mol. Its IUPAC name is N-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfamoyl]-4-(2-nitrophenyl)-4-oxobutanamide.
| Compound Name | N-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfamoyl]-4-(2-nitrophenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 130383124 |
| Molecular Formula | C20H22N8O9S |
| Molecular Weight | 550.51 g/mol |
| Exact Mass | 550.12 |
| IUPAC Name | N-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfamoyl]-4-(2-nitrophenyl)-4-oxobutanamide |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CNS(=O)(=O)NC(=O)CCC(=O)c2ccccc2[N+](=O)[O-])[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H22N8O9S/c21-18-15-19(23-8-22-18)27(9-24-15)20-17(32)16(31)13(37-20)7-25-38(35,36)26-14(30)6-5-12(29)10-3-1-2-4-11(10)28(33)34/h1-4,8-9,13,16-17,20,25,31-32H,5-7H2,(H,26,30)(H2,21,22,23)/t13-,16-,17-,20-/m1/s1 |
| InChIKey | YLKAJPYEUNOWMK-AEVYOOLXSA-N |
| XLogP | -1.45 |
| TPSA | 254.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.51 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|