C17H17N7O9S — CID 91406023
N-[6-amino-9-[(2R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]sulfonyl-2-nitrobenzamide (PubChem CID 91406023) has the molecular formula C17H17N7O9S and a molecular weight of 495.43 g/mol. Its IUPAC name is N-[6-amino-9-[(2R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]sulfonyl-2-nitrobenzamide.
| Compound Name | N-[6-amino-9-[(2R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]sulfonyl-2-nitrobenzamide |
|---|---|
| PubChem CID | 91406023 |
| Molecular Formula | C17H17N7O9S |
| Molecular Weight | 495.43 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | N-[6-amino-9-[(2R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]sulfonyl-2-nitrobenzamide |
| SMILES | Nc1nc(S(=O)(=O)NC(=O)c2ccccc2[N+](=O)[O-])nc2c1ncn2[C@@H]1O[C@H](CO)C(O)C1O |
| InChI | InChI=1S/C17H17N7O9S/c18-13-10-14(23(6-19-10)16-12(27)11(26)9(5-25)33-16)21-17(20-13)34(31,32)22-15(28)7-3-1-2-4-8(7)24(29)30/h1-4,6,9,11-12,16,25-27H,5H2,(H,22,28)(H2,18,20,21)/t9-,11?,12?,16-/m1/s1 |
| InChIKey | NHLMEQKFAIEDCC-ZDAQOXLSSA-N |
| XLogP | -1.95 |
| TPSA | 245.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.43 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|