C20H32N6O16 — CID 69027317
acetic acid;(2R,3R,4S,5R)-2-(6-amino-2-nitropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 69027317) has the molecular formula C20H32N6O16 and a molecular weight of 612.50 g/mol. Its IUPAC name is acetic acid;(2R,3R,4S,5R)-2-(6-amino-2-nitropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | acetic acid;(2R,3R,4S,5R)-2-(6-amino-2-nitropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 69027317 |
| Molecular Formula | C20H32N6O16 |
| Molecular Weight | 612.50 g/mol |
| Exact Mass | 612.19 |
| IUPAC Name | acetic acid;(2R,3R,4S,5R)-2-(6-amino-2-nitropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CC(=O)O.CC(=O)O.CC(=O)O.CC(=O)O.CC(=O)O.Nc1nc([N+](=O)[O-])nc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H12N6O6.5C2H4O2/c11-7-4-8(14-10(13-7)16(20)21)15(2-12-4)9-6(19)5(18)3(1-17)22-9;5*1-2(3)4/h2-3,5-6,9,17-19H,1H2,(H2,11,13,14);5*1H3,(H,3,4)/t3-,5-,6-,9-;;;;;/m1...../s1 |
| InChIKey | HBTDXOVIHURMKK-LTPGDGGNSA-N |
| XLogP | -1.62 |
| TPSA | 369.18 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.50 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|