C24H22N6O11S — CID 130383145
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[4-[2-(2-hydroxy-3,4-dioxocyclobuten-1-yl)phenyl]-4-oxobutanoyl]sulfamate (PubChem CID 130383145) has the molecular formula C24H22N6O11S and a molecular weight of 602.54 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[4-[2-(2-hydroxy-3,4-dioxocyclobuten-1-yl)phenyl]-4-oxobutanoyl]sulfamate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[4-[2-(2-hydroxy-3,4-dioxocyclobuten-1-yl)phenyl]-4-oxobutanoyl]sulfamate |
|---|---|
| PubChem CID | 130383145 |
| Molecular Formula | C24H22N6O11S |
| Molecular Weight | 602.54 g/mol |
| Exact Mass | 602.11 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[4-[2-(2-hydroxy-3,4-dioxocyclobuten-1-yl)phenyl]-4-oxobutanoyl]sulfamate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COS(=O)(=O)NC(=O)CCC(=O)c2ccccc2-c2c(O)c(=O)c2=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C24H22N6O11S/c25-22-16-23(27-8-26-22)30(9-28-16)24-21(37)17(33)13(41-24)7-40-42(38,39)29-14(32)6-5-12(31)10-3-1-2-4-11(10)15-18(34)20(36)19(15)35/h1-4,8-9,13,17,21,24,33-34,37H,5-7H2,(H,29,32)(H2,25,26,27)/t13-,17-,21-,24-/m1/s1 |
| InChIKey | SRSXLYAOQDOTTQ-OWROYETOSA-N |
| XLogP | -1.96 |
| TPSA | 263.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.54 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|