C21H32N6O9S — CID 162674110
methyl 10-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxysulfonylamino]-10-oxodecanoate (PubChem CID 162674110) has the molecular formula C21H32N6O9S and a molecular weight of 544.59 g/mol. Its IUPAC name is methyl 10-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxysulfonylamino]-10-oxodecanoate.
| Compound Name | methyl 10-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxysulfonylamino]-10-oxodecanoate |
|---|---|
| PubChem CID | 162674110 |
| Molecular Formula | C21H32N6O9S |
| Molecular Weight | 544.59 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | methyl 10-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxysulfonylamino]-10-oxodecanoate |
| SMILES | COC(=O)CCCCCCCCC(=O)NS(=O)(=O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H32N6O9S/c1-34-15(29)9-7-5-3-2-4-6-8-14(28)26-37(32,33)35-10-13-17(30)18(31)21(36-13)27-12-25-16-19(22)23-11-24-20(16)27/h11-13,17-18,21,30-31H,2-10H2,1H3,(H,26,28)(H2,22,23,24)/t13-,17-,18-,21-/m1/s1 |
| InChIKey | GSZDZVZLDONQBT-RAXVHSSMSA-N |
| XLogP | -0.30 |
| TPSA | 218.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.59 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|