C22H36N6O8S — CID 166606598
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-(2-decoxyacetyl)sulfamate (PubChem CID 166606598) has the molecular formula C22H36N6O8S and a molecular weight of 544.63 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-(2-decoxyacetyl)sulfamate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-(2-decoxyacetyl)sulfamate |
|---|---|
| PubChem CID | 166606598 |
| Molecular Formula | C22H36N6O8S |
| Molecular Weight | 544.63 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-(2-decoxyacetyl)sulfamate |
| SMILES | CCCCCCCCCCOCC(=O)NS(=O)(=O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H36N6O8S/c1-2-3-4-5-6-7-8-9-10-34-12-16(29)27-37(32,33)35-11-15-18(30)19(31)22(36-15)28-14-26-17-20(23)24-13-25-21(17)28/h13-15,18-19,22,30-31H,2-12H2,1H3,(H,27,29)(H2,23,24,25)/t15-,18-,19-,22-/m1/s1 |
| InChIKey | DJGLQPWJILJNFY-CIVUBGFFSA-N |
| XLogP | 0.56 |
| TPSA | 201.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.63 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|