C22H36N6O7S — CID 162670847
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[(2R)-2-methylundecanoyl]sulfamate (PubChem CID 162670847) has the molecular formula C22H36N6O7S and a molecular weight of 528.63 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[(2R)-2-methylundecanoyl]sulfamate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[(2R)-2-methylundecanoyl]sulfamate |
|---|---|
| PubChem CID | 162670847 |
| Molecular Formula | C22H36N6O7S |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[(2R)-2-methylundecanoyl]sulfamate |
| SMILES | CCCCCCCCC[C@@H](C)C(=O)NS(=O)(=O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H36N6O7S/c1-3-4-5-6-7-8-9-10-14(2)21(31)27-36(32,33)34-11-15-17(29)18(30)22(35-15)28-13-26-16-19(23)24-12-25-20(16)28/h12-15,17-18,22,29-30H,3-11H2,1-2H3,(H,27,31)(H2,23,24,25)/t14-,15-,17-,18-,22-/m1/s1 |
| InChIKey | YHJBQVKMEHMNSJ-JBDHLQPBSA-N |
| XLogP | 1.18 |
| TPSA | 191.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|