C16H22N6O9S — CID 155526371
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[(2S,3R)-3-cyclopropyl-2,3-dihydroxypropanoyl]sulfamate (PubChem CID 155526371) has the molecular formula C16H22N6O9S and a molecular weight of 474.45 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[(2S,3R)-3-cyclopropyl-2,3-dihydroxypropanoyl]sulfamate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[(2S,3R)-3-cyclopropyl-2,3-dihydroxypropanoyl]sulfamate |
|---|---|
| PubChem CID | 155526371 |
| Molecular Formula | C16H22N6O9S |
| Molecular Weight | 474.45 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[(2S,3R)-3-cyclopropyl-2,3-dihydroxypropanoyl]sulfamate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COS(=O)(=O)NC(=O)[C@@H](O)[C@H](O)C2CC2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H22N6O9S/c17-13-8-14(19-4-18-13)22(5-20-8)16-12(26)10(24)7(31-16)3-30-32(28,29)21-15(27)11(25)9(23)6-1-2-6/h4-7,9-12,16,23-26H,1-3H2,(H,21,27)(H2,17,18,19)/t7-,9-,10-,11+,12-,16-/m1/s1 |
| InChIKey | LWJBQWKPMZYIQP-XHKGYQPESA-N |
| XLogP | -3.46 |
| TPSA | 232.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.45 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |