C16H23IN6O8S — CID 132941104
[(2R,3S,4R,5R)-5-(6-amino-2-iodopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[(2S)-2-hydroxy-4-methylpentanoyl]sulfamate (PubChem CID 132941104) has the molecular formula C16H23IN6O8S and a molecular weight of 586.37 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-amino-2-iodopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[(2S)-2-hydroxy-4-methylpentanoyl]sulfamate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-amino-2-iodopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[(2S)-2-hydroxy-4-methylpentanoyl]sulfamate |
|---|---|
| PubChem CID | 132941104 |
| Molecular Formula | C16H23IN6O8S |
| Molecular Weight | 586.37 g/mol |
| Exact Mass | 586.03 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-amino-2-iodopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[(2S)-2-hydroxy-4-methylpentanoyl]sulfamate |
| SMILES | CC(C)C[C@H](O)C(=O)NS(=O)(=O)OC[C@H]1O[C@@H](n2cnc3c(N)nc(I)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H23IN6O8S/c1-6(2)3-7(24)14(27)22-32(28,29)30-4-8-10(25)11(26)15(31-8)23-5-19-9-12(18)20-16(17)21-13(9)23/h5-8,10-11,15,24-26H,3-4H2,1-2H3,(H,22,27)(H2,18,20,21)/t7-,8+,10+,11+,15+/m0/s1 |
| InChIKey | WHBKHJPUBVIUDX-JVEUSOJLSA-N |
| XLogP | -1.58 |
| TPSA | 212.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.37 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|