C17H25IN6O7S2 — CID 87068515
[(2R,3S,4R,5R)-3,4-dihydroxy-5-[2-iodo-6-(methylamino)purin-9-yl]oxolan-2-yl]methyl N-[(2S)-2-methyl-4-methylsulfanylbutanoyl]sulfamate (PubChem CID 87068515) has the molecular formula C17H25IN6O7S2 and a molecular weight of 616.46 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-[2-iodo-6-(methylamino)purin-9-yl]oxolan-2-yl]methyl N-[(2S)-2-methyl-4-methylsulfanylbutanoyl]sulfamate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[2-iodo-6-(methylamino)purin-9-yl]oxolan-2-yl]methyl N-[(2S)-2-methyl-4-methylsulfanylbutanoyl]sulfamate |
|---|---|
| PubChem CID | 87068515 |
| Molecular Formula | C17H25IN6O7S2 |
| Molecular Weight | 616.46 g/mol |
| Exact Mass | 616.03 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[2-iodo-6-(methylamino)purin-9-yl]oxolan-2-yl]methyl N-[(2S)-2-methyl-4-methylsulfanylbutanoyl]sulfamate |
| SMILES | CNc1nc(I)nc2c1ncn2[C@@H]1O[C@H](COS(=O)(=O)NC(=O)[C@@H](C)CCSC)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H25IN6O7S2/c1-8(4-5-32-3)15(27)23-33(28,29)30-6-9-11(25)12(26)16(31-9)24-7-20-10-13(19-2)21-17(18)22-14(10)24/h7-9,11-12,16,25-26H,4-6H2,1-3H3,(H,23,27)(H,19,21,22)/t8-,9+,11+,12+,16+/m0/s1 |
| InChIKey | NHNPJKRZWRACDK-LEJQEAHTSA-N |
| XLogP | -0.14 |
| TPSA | 177.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.46 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|