C16H25N7O7S2 — CID 24864470
[(2R,3S,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxan-2-yl]methyl N-[(2S)-2-amino-4-methylsulfanylbutanoyl]sulfamate (PubChem CID 24864470) has the molecular formula C16H25N7O7S2 and a molecular weight of 491.55 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxan-2-yl]methyl N-[(2S)-2-amino-4-methylsulfanylbutanoyl]sulfamate.
| Compound Name | [(2R,3S,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxan-2-yl]methyl N-[(2S)-2-amino-4-methylsulfanylbutanoyl]sulfamate |
|---|---|
| PubChem CID | 24864470 |
| Molecular Formula | C16H25N7O7S2 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | [(2R,3S,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxan-2-yl]methyl N-[(2S)-2-amino-4-methylsulfanylbutanoyl]sulfamate |
| SMILES | CSCC[C@H](N)C(=O)NS(=O)(=O)OC[C@H]1OC[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H25N7O7S2/c1-31-3-2-8(17)16(26)22-32(27,28)30-5-10-13(25)12(24)9(4-29-10)23-7-21-11-14(18)19-6-20-15(11)23/h6-10,12-13,24-25H,2-5,17H2,1H3,(H,22,26)(H2,18,19,20)/t8-,9+,10+,12-,13+/m0/s1 |
| InChIKey | XHRFZFFRUDJABT-YQPPGCHHSA-N |
| XLogP | -2.47 |
| TPSA | 217.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |