C16H24N6O7S2 — CID 160766176
[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl (3S)-3-amino-5-methylsulfanyl-2-oxopentane-1-sulfonate (PubChem CID 160766176) has the molecular formula C16H24N6O7S2 and a molecular weight of 476.54 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl (3S)-3-amino-5-methylsulfanyl-2-oxopentane-1-sulfonate.
| Compound Name | [(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl (3S)-3-amino-5-methylsulfanyl-2-oxopentane-1-sulfonate |
|---|---|
| PubChem CID | 160766176 |
| Molecular Formula | C16H24N6O7S2 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl (3S)-3-amino-5-methylsulfanyl-2-oxopentane-1-sulfonate |
| SMILES | CSCC[C@H](N)C(=O)CS(=O)(=O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H24N6O7S2/c1-30-3-2-8(17)9(23)5-31(26,27)28-4-10-12(24)13(25)16(29-10)22-7-21-11-14(18)19-6-20-15(11)22/h6-8,10,12-13,16,24-25H,2-5,17H2,1H3,(H2,18,19,20)/t8-,10+,12-,13+,16+/m0/s1 |
| InChIKey | GZAZJPLQQHTKCY-GXFXRVQVSA-N |
| XLogP | -1.98 |
| TPSA | 205.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|