C17H20N6O8S — CID 89168338
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-(2-hydroxycyclohexa-1,5-diene-1-carbonyl)sulfamate (PubChem CID 89168338) has the molecular formula C17H20N6O8S and a molecular weight of 468.45 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-(2-hydroxycyclohexa-1,5-diene-1-carbonyl)sulfamate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-(2-hydroxycyclohexa-1,5-diene-1-carbonyl)sulfamate |
|---|---|
| PubChem CID | 89168338 |
| Molecular Formula | C17H20N6O8S |
| Molecular Weight | 468.45 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-(2-hydroxycyclohexa-1,5-diene-1-carbonyl)sulfamate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COS(=O)(=O)NC(=O)C2=C(O)CCC=C2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H20N6O8S/c18-14-11-15(20-6-19-14)23(7-21-11)17-13(26)12(25)10(31-17)5-30-32(28,29)22-16(27)8-3-1-2-4-9(8)24/h1,3,6-7,10,12-13,17,24-26H,2,4-5H2,(H,22,27)(H2,18,19,20)/t10-,12-,13-,17-/m1/s1 |
| InChIKey | DVHWSXKRIRCFAA-CNEMSGBDSA-N |
| XLogP | -1.43 |
| TPSA | 212.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.45 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |