C21H22N6O10S — CID 119081235
3-[4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxysulfonylamino]-4-oxobutanoyl]benzoic acid (PubChem CID 119081235) has the molecular formula C21H22N6O10S and a molecular weight of 550.51 g/mol. Its IUPAC name is 3-[4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxysulfonylamino]-4-oxobutanoyl]benzoic acid.
| Compound Name | 3-[4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxysulfonylamino]-4-oxobutanoyl]benzoic acid |
|---|---|
| PubChem CID | 119081235 |
| Molecular Formula | C21H22N6O10S |
| Molecular Weight | 550.51 g/mol |
| Exact Mass | 550.11 |
| IUPAC Name | 3-[4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxysulfonylamino]-4-oxobutanoyl]benzoic acid |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COS(=O)(=O)NC(=O)CCC(=O)c2cccc(C(=O)O)c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H22N6O10S/c22-18-15-19(24-8-23-18)27(9-25-15)20-17(31)16(30)13(37-20)7-36-38(34,35)26-14(29)5-4-12(28)10-2-1-3-11(6-10)21(32)33/h1-3,6,8-9,13,16-17,20,30-31H,4-5,7H2,(H,26,29)(H,32,33)(H2,22,23,24)/t13-,16-,17-,20-/m1/s1 |
| InChIKey | PDIONKWATCXVCX-AEVYOOLXSA-N |
| XLogP | -1.23 |
| TPSA | 246.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.51 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |