C15H22N8O6S — CID 145208096
(2S)-N-[[(2R,3R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfamoyl]pyrrolidine-2-carboxamide (PubChem CID 145208096) has the molecular formula C15H22N8O6S and a molecular weight of 442.46 g/mol. Its IUPAC name is (2S)-N-[[(2R,3R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfamoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[[(2R,3R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfamoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 145208096 |
| Molecular Formula | C15H22N8O6S |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | (2S)-N-[[(2R,3R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfamoyl]pyrrolidine-2-carboxamide |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CNS(=O)(=O)NC(=O)[C@@H]2CCCN2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H22N8O6S/c16-12-9-13(19-5-18-12)23(6-20-9)15-11(25)10(24)8(29-15)4-21-30(27,28)22-14(26)7-2-1-3-17-7/h5-8,10-11,15,17,21,24-25H,1-4H2,(H,22,26)(H2,16,18,19)/t7-,8+,10-,11-,15+/m0/s1 |
| InChIKey | MJYOATWPFISSRW-NTFFAHPLSA-N |
| XLogP | -3.27 |
| TPSA | 206.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |