C27H37N7O9SSi — CID 157326804
[(2S,3R,5R)-5-(6-aminopurin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyloxolan-2-yl]methyl N-[4-(2-nitrophenyl)-4-oxobutanoyl]sulfamate (PubChem CID 157326804) has the molecular formula C27H37N7O9SSi and a molecular weight of 663.79 g/mol. Its IUPAC name is [(2S,3R,5R)-5-(6-aminopurin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyloxolan-2-yl]methyl N-[4-(2-nitrophenyl)-4-oxobutanoyl]sulfamate.
| Compound Name | [(2S,3R,5R)-5-(6-aminopurin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyloxolan-2-yl]methyl N-[4-(2-nitrophenyl)-4-oxobutanoyl]sulfamate |
|---|---|
| PubChem CID | 157326804 |
| Molecular Formula | C27H37N7O9SSi |
| Molecular Weight | 663.79 g/mol |
| Exact Mass | 663.21 |
| IUPAC Name | [(2S,3R,5R)-5-(6-aminopurin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyloxolan-2-yl]methyl N-[4-(2-nitrophenyl)-4-oxobutanoyl]sulfamate |
| SMILES | C[C@H]1C(O[Si](C)(C)C(C)(C)C)[C@H](n2cnc3c(N)ncnc32)O[C@@H]1COS(=O)(=O)NC(=O)CCC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H37N7O9SSi/c1-16-20(13-41-44(39,40)32-21(36)12-11-19(35)17-9-7-8-10-18(17)34(37)38)42-26(23(16)43-45(5,6)27(2,3)4)33-15-31-22-24(28)29-14-30-25(22)33/h7-10,14-16,20,23,26H,11-13H2,1-6H3,(H,32,36)(H2,28,29,30)/t16-,20-,23?,26-/m1/s1 |
| InChIKey | BEVAONDBXJDDMC-JRCOIQBDSA-N |
| XLogP | 3.28 |
| TPSA | 220.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.79 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|