C28H31N6O7PS2 — CID 10211739
S-[2-[[[5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl]amino]-(2-benzoylsulfanylethoxy)phosphoryl]oxyethyl] benzenecarbothioate (PubChem CID 10211739) has the molecular formula C28H31N6O7PS2 and a molecular weight of 658.70 g/mol. Its IUPAC name is S-[2-[[[5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl]amino]-(2-benzoylsulfanylethoxy)phosphoryl]oxyethyl] benzenecarbothioate.
| Compound Name | S-[2-[[[5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl]amino]-(2-benzoylsulfanylethoxy)phosphoryl]oxyethyl] benzenecarbothioate |
|---|---|
| PubChem CID | 10211739 |
| Molecular Formula | C28H31N6O7PS2 |
| Molecular Weight | 658.70 g/mol |
| Exact Mass | 658.14 |
| IUPAC Name | S-[2-[[[5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl]amino]-(2-benzoylsulfanylethoxy)phosphoryl]oxyethyl] benzenecarbothioate |
| SMILES | Nc1ncnc2c1ncn2C1CC(NP(=O)(OCCSC(=O)c2ccccc2)OCCSC(=O)c2ccccc2)C(CO)O1 |
| InChI | InChI=1S/C28H31N6O7PS2/c29-25-24-26(31-17-30-25)34(18-32-24)23-15-21(22(16-35)41-23)33-42(38,39-11-13-43-27(36)19-7-3-1-4-8-19)40-12-14-44-28(37)20-9-5-2-6-10-20/h1-10,17-18,21-23,35H,11-16H2,(H,33,38)(H2,29,30,31) |
| InChIKey | YEVUXJLADCDTOH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 180.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.70 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|