C12H16N5O6P — CID 90178631
2-[3-(6-aminopurin-9-yl)cyclopentyl]oxy-2-phosphonoacetic acid (PubChem CID 90178631) has the molecular formula C12H16N5O6P and a molecular weight of 357.26 g/mol. Its IUPAC name is 2-[3-(6-aminopurin-9-yl)cyclopentyl]oxy-2-phosphonoacetic acid.
| Compound Name | 2-[3-(6-aminopurin-9-yl)cyclopentyl]oxy-2-phosphonoacetic acid |
|---|---|
| PubChem CID | 90178631 |
| Molecular Formula | C12H16N5O6P |
| Molecular Weight | 357.26 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 2-[3-(6-aminopurin-9-yl)cyclopentyl]oxy-2-phosphonoacetic acid |
| SMILES | Nc1ncnc2c1ncn2C1CCC(OC(C(=O)O)P(=O)(O)O)C1 |
| InChI | InChI=1S/C12H16N5O6P/c13-9-8-10(15-4-14-9)17(5-16-8)6-1-2-7(3-6)23-12(11(18)19)24(20,21)22/h4-7,12H,1-3H2,(H,18,19)(H2,13,14,15)(H2,20,21,22) |
| InChIKey | AGCDAIVJGHVYFF-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 173.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.26 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|