C12H13ClN4 — CID 56676591
9-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-6-chloropurine (PubChem CID 56676591) has the molecular formula C12H13ClN4 and a molecular weight of 248.72 g/mol. Its IUPAC name is 9-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-6-chloropurine.
| Compound Name | 9-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-6-chloropurine |
|---|---|
| PubChem CID | 56676591 |
| Molecular Formula | C12H13ClN4 |
| Molecular Weight | 248.72 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 9-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-6-chloropurine |
| SMILES | Clc1ncnc2c1ncn2[C@H]1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C12H13ClN4/c13-11-10-12(15-5-14-11)17(6-16-10)9-4-7-1-2-8(9)3-7/h5-9H,1-4H2/t7-,8-,9+/m1/s1 |
| InChIKey | HCMOLGILLULWHJ-HLTSFMKQSA-N |
| XLogP | 2.84 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.72 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |