C11H12ClFN4O — CID 59964788
6-chloro-9-[(2R,5R)-5-ethyl-3-fluorooxolan-2-yl]purine (PubChem CID 59964788) has the molecular formula C11H12ClFN4O and a molecular weight of 270.70 g/mol. Its IUPAC name is 6-chloro-9-[(2R,5R)-5-ethyl-3-fluorooxolan-2-yl]purine.
| Compound Name | 6-chloro-9-[(2R,5R)-5-ethyl-3-fluorooxolan-2-yl]purine |
|---|---|
| PubChem CID | 59964788 |
| Molecular Formula | C11H12ClFN4O |
| Molecular Weight | 270.70 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 6-chloro-9-[(2R,5R)-5-ethyl-3-fluorooxolan-2-yl]purine |
| SMILES | CC[C@@H]1CC(F)[C@H](n2cnc3c(Cl)ncnc32)O1 |
| InChI | InChI=1S/C11H12ClFN4O/c1-2-6-3-7(13)11(18-6)17-5-16-8-9(12)14-4-15-10(8)17/h4-7,11H,2-3H2,1H3/t6-,7?,11-/m1/s1 |
| InChIKey | MAFRCMDKFSIAAZ-UHIYAXTESA-N |
| XLogP | 2.52 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.70 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |