C20H25N5O4 — CID 87847019
9-[(3aS,4R,6R,6aR)-6-ethynyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-(3-methoxycyclopentyl)purin-6-amine (PubChem CID 87847019) has the molecular formula C20H25N5O4 and a molecular weight of 399.45 g/mol. Its IUPAC name is 9-[(3aS,4R,6R,6aR)-6-ethynyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-(3-methoxycyclopentyl)purin-6-amine.
| Compound Name | 9-[(3aS,4R,6R,6aR)-6-ethynyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-(3-methoxycyclopentyl)purin-6-amine |
|---|---|
| PubChem CID | 87847019 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 9-[(3aS,4R,6R,6aR)-6-ethynyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-N-(3-methoxycyclopentyl)purin-6-amine |
| SMILES | C#C[C@H]1O[C@@H](n2cnc3c(NC4CCC(OC)C4)ncnc32)[C@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C20H25N5O4/c1-5-13-15-16(29-20(2,3)28-15)19(27-13)25-10-23-14-17(21-9-22-18(14)25)24-11-6-7-12(8-11)26-4/h1,9-13,15-16,19H,6-8H2,2-4H3,(H,21,22,24)/t11?,12?,13-,15-,16+,19-/m1/s1 |
| InChIKey | DPKUNAYYMYMBDC-KCENQWRFSA-N |
| XLogP | 1.86 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|