C21H27N5O3 — CID 87847421
[9-[(3aS,4R,6R,6aR)-6-ethynyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]-cyclohexylmethanamine (PubChem CID 87847421) has the molecular formula C21H27N5O3 and a molecular weight of 397.48 g/mol. Its IUPAC name is [9-[(3aS,4R,6R,6aR)-6-ethynyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]-cyclohexylmethanamine.
| Compound Name | [9-[(3aS,4R,6R,6aR)-6-ethynyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]-cyclohexylmethanamine |
|---|---|
| PubChem CID | 87847421 |
| Molecular Formula | C21H27N5O3 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | [9-[(3aS,4R,6R,6aR)-6-ethynyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]-cyclohexylmethanamine |
| SMILES | C#C[C@H]1O[C@@H](n2cnc3c(C(N)C4CCCCC4)ncnc32)[C@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C21H27N5O3/c1-4-13-17-18(29-21(2,3)28-17)20(27-13)26-11-25-16-15(23-10-24-19(16)26)14(22)12-8-6-5-7-9-12/h1,10-14,17-18,20H,5-9,22H2,2-3H3/t13-,14?,17-,18+,20-/m1/s1 |
| InChIKey | ZHUNQPHOWGJGGU-BPZWTHLISA-N |
| XLogP | 2.46 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|