C19H23N5O4 — CID 87845678
2-[9-[(3aR,4R,6R,6aR)-6-ethynyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]oxan-3-amine (PubChem CID 87845678) has the molecular formula C19H23N5O4 and a molecular weight of 385.42 g/mol. Its IUPAC name is 2-[9-[(3aR,4R,6R,6aR)-6-ethynyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]oxan-3-amine.
| Compound Name | 2-[9-[(3aR,4R,6R,6aR)-6-ethynyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]oxan-3-amine |
|---|---|
| PubChem CID | 87845678 |
| Molecular Formula | C19H23N5O4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 2-[9-[(3aR,4R,6R,6aR)-6-ethynyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]oxan-3-amine |
| SMILES | C#C[C@H]1O[C@@H](n2cnc3c(C4OCCCC4N)ncnc32)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C19H23N5O4/c1-4-11-15-16(28-19(2,3)27-15)18(26-11)24-9-23-13-12(21-8-22-17(13)24)14-10(20)6-5-7-25-14/h1,8-11,14-16,18H,5-7,20H2,2-3H3/t10?,11-,14?,15-,16-,18-/m1/s1 |
| InChIKey | KDKQBWKBCOUWNP-IOGGIHJKSA-N |
| XLogP | 1.06 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|