C21H21ClN4O4 — CID 140822390
[(3aR,4R,6R,6aR)-4-[6-[2-(3-chlorophenyl)ethenyl]purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol (PubChem CID 140822390) has the molecular formula C21H21ClN4O4 and a molecular weight of 428.88 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-4-[6-[2-(3-chlorophenyl)ethenyl]purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol.
| Compound Name | [(3aR,4R,6R,6aR)-4-[6-[2-(3-chlorophenyl)ethenyl]purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol |
|---|---|
| PubChem CID | 140822390 |
| Molecular Formula | C21H21ClN4O4 |
| Molecular Weight | 428.88 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | [(3aR,4R,6R,6aR)-4-[6-[2-(3-chlorophenyl)ethenyl]purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CO)O[C@H]2n1cnc2c(C=Cc3cccc(Cl)c3)ncnc21 |
| InChI | InChI=1S/C21H21ClN4O4/c1-21(2)29-17-15(9-27)28-20(18(17)30-21)26-11-25-16-14(23-10-24-19(16)26)7-6-12-4-3-5-13(22)8-12/h3-8,10-11,15,17-18,20,27H,9H2,1-2H3/t15-,17-,18-,20-/m1/s1 |
| InChIKey | LSFSQNOCIVOGOM-DLVXIWMQSA-N |
| XLogP | 3.06 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.88 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |