C34H36N6O7 — CID 101422542
ethyl (E)-6-[(3aR,4R,6R,6aR)-4-(6-benzamidopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-benzamidohex-5-enoate (PubChem CID 101422542) has the molecular formula C34H36N6O7 and a molecular weight of 640.70 g/mol. Its IUPAC name is ethyl (E)-6-[(3aR,4R,6R,6aR)-4-(6-benzamidopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-benzamidohex-5-enoate.
| Compound Name | ethyl (E)-6-[(3aR,4R,6R,6aR)-4-(6-benzamidopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-benzamidohex-5-enoate |
|---|---|
| PubChem CID | 101422542 |
| Molecular Formula | C34H36N6O7 |
| Molecular Weight | 640.70 g/mol |
| Exact Mass | 640.26 |
| IUPAC Name | ethyl (E)-6-[(3aR,4R,6R,6aR)-4-(6-benzamidopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-benzamidohex-5-enoate |
| SMILES | CCOC(=O)C(CC/C=C/[C@H]1O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@@H]2OC(C)(C)O[C@@H]21)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C34H36N6O7/c1-4-44-33(43)23(38-30(41)21-13-7-5-8-14-21)17-11-12-18-24-26-27(47-34(2,3)46-26)32(45-24)40-20-37-25-28(35-19-36-29(25)40)39-31(42)22-15-9-6-10-16-22/h5-10,12-16,18-20,23-24,26-27,32H,4,11,17H2,1-3H3,(H,38,41)(H,35,36,39,42)/b18-12+/t23?,24-,26-,27-,32-/m1/s1 |
| InChIKey | TUFIAHPLDUQJTR-VCKIKEQASA-N |
| XLogP | 4.19 |
| TPSA | 155.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.70 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|