C25H29N8O7P — CID 86641128
N-[9-[(3aS,4R,6R,6aR)-4-azido-4-[(E)-2-diethoxyphosphorylethenyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]purin-6-yl]benzamide (PubChem CID 86641128) has the molecular formula C25H29N8O7P and a molecular weight of 584.53 g/mol. Its IUPAC name is N-[9-[(3aS,4R,6R,6aR)-4-azido-4-[(E)-2-diethoxyphosphorylethenyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(3aS,4R,6R,6aR)-4-azido-4-[(E)-2-diethoxyphosphorylethenyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 86641128 |
| Molecular Formula | C25H29N8O7P |
| Molecular Weight | 584.53 g/mol |
| Exact Mass | 584.19 |
| IUPAC Name | N-[9-[(3aS,4R,6R,6aR)-4-azido-4-[(E)-2-diethoxyphosphorylethenyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]purin-6-yl]benzamide |
| SMILES | CCOP(=O)(/C=C/[C@@]1(N=[N+]=[N-])O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@@H]2OC(C)(C)O[C@@H]21)OCC |
| InChI | InChI=1S/C25H29N8O7P/c1-5-36-41(35,37-6-2)13-12-25(31-32-26)19-18(38-24(3,4)39-19)23(40-25)33-15-29-17-20(27-14-28-21(17)33)30-22(34)16-10-8-7-9-11-16/h7-15,18-19,23H,5-6H2,1-4H3,(H,27,28,30,34)/b13-12+/t18-,19+,23-,25-/m1/s1 |
| InChIKey | AHWZJGDTKYMFMT-MINXQVNZSA-N |
| XLogP | 4.91 |
| TPSA | 184.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.53 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|