C22H27N8O6P — CID 25152738
(3S,4R,5R)-2-azido-5-[6-(benzylamino)purin-9-yl]-2-[(E)-2-diethoxyphosphorylethenyl]oxolane-3,4-diol (PubChem CID 25152738) has the molecular formula C22H27N8O6P and a molecular weight of 530.48 g/mol. Its IUPAC name is (3S,4R,5R)-2-azido-5-[6-(benzylamino)purin-9-yl]-2-[(E)-2-diethoxyphosphorylethenyl]oxolane-3,4-diol.
| Compound Name | (3S,4R,5R)-2-azido-5-[6-(benzylamino)purin-9-yl]-2-[(E)-2-diethoxyphosphorylethenyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 25152738 |
| Molecular Formula | C22H27N8O6P |
| Molecular Weight | 530.48 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | (3S,4R,5R)-2-azido-5-[6-(benzylamino)purin-9-yl]-2-[(E)-2-diethoxyphosphorylethenyl]oxolane-3,4-diol |
| SMILES | CCOP(=O)(/C=C/C1(N=[N+]=[N-])O[C@@H](n2cnc3c(NCc4ccccc4)ncnc32)[C@H](O)[C@@H]1O)OCC |
| InChI | InChI=1S/C22H27N8O6P/c1-3-34-37(33,35-4-2)11-10-22(28-29-23)18(32)17(31)21(36-22)30-14-27-16-19(25-13-26-20(16)30)24-12-15-8-6-5-7-9-15/h5-11,13-14,17-18,21,31-32H,3-4,12H2,1-2H3,(H,24,25,26)/b11-10+/t17-,18+,21-,22?/m1/s1 |
| InChIKey | OFPCCQYSPRBPTF-ANZSSATQSA-N |
| XLogP | 3.48 |
| TPSA | 189.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|