C18H19FN5O5P — CID 25153376
[(E)-2-[(2R,3R,4S,5R)-5-[6-(benzylamino)purin-9-yl]-4-fluoro-3-hydroxyoxolan-2-yl]ethenyl]phosphonic acid (PubChem CID 25153376) has the molecular formula C18H19FN5O5P and a molecular weight of 435.35 g/mol. Its IUPAC name is [(E)-2-[(2R,3R,4S,5R)-5-[6-(benzylamino)purin-9-yl]-4-fluoro-3-hydroxyoxolan-2-yl]ethenyl]phosphonic acid.
| Compound Name | [(E)-2-[(2R,3R,4S,5R)-5-[6-(benzylamino)purin-9-yl]-4-fluoro-3-hydroxyoxolan-2-yl]ethenyl]phosphonic acid |
|---|---|
| PubChem CID | 25153376 |
| Molecular Formula | C18H19FN5O5P |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | [(E)-2-[(2R,3R,4S,5R)-5-[6-(benzylamino)purin-9-yl]-4-fluoro-3-hydroxyoxolan-2-yl]ethenyl]phosphonic acid |
| SMILES | O=P(O)(O)/C=C/[C@H]1O[C@@H](n2cnc3c(NCc4ccccc4)ncnc32)[C@@H](F)[C@@H]1O |
| InChI | InChI=1S/C18H19FN5O5P/c19-13-15(25)12(6-7-30(26,27)28)29-18(13)24-10-23-14-16(21-9-22-17(14)24)20-8-11-4-2-1-3-5-11/h1-7,9-10,12-13,15,18,25H,8H2,(H,20,21,22)(H2,26,27,28)/b7-6+/t12-,13+,15-,18-/m1/s1 |
| InChIKey | ZUTKDZGRNDWRGO-RVANYTNHSA-N |
| XLogP | 1.73 |
| TPSA | 142.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|