C11H15FN7O5P — CID 70899795
(3R,4R,5R)-5-(6-aminopurin-9-yl)-2-[(E)-2-bis(hydroxyamino)phosphorylethenyl]-4-fluorooxolan-3-ol (PubChem CID 70899795) has the molecular formula C11H15FN7O5P and a molecular weight of 375.26 g/mol. Its IUPAC name is (3R,4R,5R)-5-(6-aminopurin-9-yl)-2-[(E)-2-bis(hydroxyamino)phosphorylethenyl]-4-fluorooxolan-3-ol.
| Compound Name | (3R,4R,5R)-5-(6-aminopurin-9-yl)-2-[(E)-2-bis(hydroxyamino)phosphorylethenyl]-4-fluorooxolan-3-ol |
|---|---|
| PubChem CID | 70899795 |
| Molecular Formula | C11H15FN7O5P |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | (3R,4R,5R)-5-(6-aminopurin-9-yl)-2-[(E)-2-bis(hydroxyamino)phosphorylethenyl]-4-fluorooxolan-3-ol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1OC(/C=C/P(=O)(NO)NO)[C@@H](O)[C@H]1F |
| InChI | InChI=1S/C11H15FN7O5P/c12-6-8(20)5(1-2-25(23,17-21)18-22)24-11(6)19-4-16-7-9(13)14-3-15-10(7)19/h1-6,8,11,20-22H,(H2,13,14,15)(H2,17,18,23)/b2-1+/t5?,6-,8-,11-/m1/s1 |
| InChIKey | CXCHSQZRXCDHEJ-RNRLMEDWSA-N |
| XLogP | -0.33 |
| TPSA | 180.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|