C11H19FN7O5P — CID 73351968
diazanium;(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-2-[(E)-2-phosphonatoethenyl]oxolan-3-ol (PubChem CID 73351968) has the molecular formula C11H19FN7O5P and a molecular weight of 379.29 g/mol. Its IUPAC name is diazanium;(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-2-[(E)-2-phosphonatoethenyl]oxolan-3-ol.
| Compound Name | diazanium;(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-2-[(E)-2-phosphonatoethenyl]oxolan-3-ol |
|---|---|
| PubChem CID | 73351968 |
| Molecular Formula | C11H19FN7O5P |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | diazanium;(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-2-[(E)-2-phosphonatoethenyl]oxolan-3-ol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](/C=C/P(=O)([O-])[O-])[C@@H](O)[C@H]1F.[NH4+].[NH4+] |
| InChI | InChI=1S/C11H13FN5O5P.2H3N/c12-6-8(18)5(1-2-23(19,20)21)22-11(6)17-4-16-7-9(13)14-3-15-10(7)17;;/h1-6,8,11,18H,(H2,13,14,15)(H2,19,20,21);2*1H3/b2-1+;;/t5-,6-,8-,11-;;/m1../s1 |
| InChIKey | NKYXGGCYDVCRIA-GNRNIKBESA-N |
| XLogP | -0.82 |
| TPSA | 235.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|