C31H32N9O9P — CID 89373098
[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] (2S)-2-[ethoxy(naphthalen-1-yl)amino]-3-phenylpropanoate (PubChem CID 89373098) has the molecular formula C31H32N9O9P and a molecular weight of 705.63 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] (2S)-2-[ethoxy(naphthalen-1-yl)amino]-3-phenylpropanoate.
| Compound Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] (2S)-2-[ethoxy(naphthalen-1-yl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 89373098 |
| Molecular Formula | C31H32N9O9P |
| Molecular Weight | 705.63 g/mol |
| Exact Mass | 705.21 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] (2S)-2-[ethoxy(naphthalen-1-yl)amino]-3-phenylpropanoate |
| SMILES | CCON(c1cccc2ccccc12)[C@@H](Cc1ccccc1)C(=O)OP(=O)(O)OC[C@@]1(N=[N+]=[N-])O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C31H32N9O9P/c1-2-46-40(22-14-8-12-20-11-6-7-13-21(20)22)23(15-19-9-4-3-5-10-19)30(43)49-50(44,45)47-16-31(37-38-33)26(42)25(41)29(48-31)39-18-36-24-27(32)34-17-35-28(24)39/h3-14,17-18,23,25-26,29,41-42H,2,15-16H2,1H3,(H,44,45)(H2,32,34,35)/t23-,25+,26-,29+,31+/m0/s1 |
| InChIKey | CUBNKFVLZWYJKD-XTLDBBHTSA-N |
| XLogP | 3.55 |
| TPSA | 253.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.63 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|