C10H13N9O4 — CID 23519643
(2R,3S,4R,5R)-2-azido-5-(2,6-diaminopurin-9-yl)-2-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 23519643) has the molecular formula C10H13N9O4 and a molecular weight of 323.27 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-azido-5-(2,6-diaminopurin-9-yl)-2-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-azido-5-(2,6-diaminopurin-9-yl)-2-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 23519643 |
| Molecular Formula | C10H13N9O4 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | (2R,3S,4R,5R)-2-azido-5-(2,6-diaminopurin-9-yl)-2-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | [N-]=[N+]=N[C@]1(CO)O[C@@H](n2cnc3c(N)nc(N)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H13N9O4/c11-6-3-7(16-9(12)15-6)19(2-14-3)8-4(21)5(22)10(1-20,23-8)17-18-13/h2,4-5,8,20-22H,1H2,(H4,11,12,15,16)/t4-,5+,8-,10-/m1/s1 |
| InChIKey | JPRMZUXBPWCNTE-LRXXKQTNSA-N |
| XLogP | -1.76 |
| TPSA | 214.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|