C10H11FN8O3 — CID 121485697
(2R,3R,5R)-5-(6-aminopurin-9-yl)-2-azido-4-fluoro-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 121485697) has the molecular formula C10H11FN8O3 and a molecular weight of 310.25 g/mol. Its IUPAC name is (2R,3R,5R)-5-(6-aminopurin-9-yl)-2-azido-4-fluoro-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,5R)-5-(6-aminopurin-9-yl)-2-azido-4-fluoro-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 121485697 |
| Molecular Formula | C10H11FN8O3 |
| Molecular Weight | 310.25 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | (2R,3R,5R)-5-(6-aminopurin-9-yl)-2-azido-4-fluoro-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | [N-]=[N+]=N[C@]1(CO)O[C@@H](n2cnc3c(N)ncnc32)C(F)[C@@H]1O |
| InChI | InChI=1S/C10H11FN8O3/c11-4-6(21)10(1-20,17-18-13)22-9(4)19-3-16-5-7(12)14-2-15-8(5)19/h2-4,6,9,20-21H,1H2,(H2,12,14,15)/t4?,6-,9+,10+/m0/s1 |
| InChIKey | KADVHRGBDQISRB-UEFGWEHPSA-N |
| XLogP | -0.36 |
| TPSA | 168.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.25 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|