C10H11N7O5 — CID 136649956
9-[(2R,5R)-5-azido-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 136649956) has the molecular formula C10H11N7O5 and a molecular weight of 309.24 g/mol. Its IUPAC name is 9-[(2R,5R)-5-azido-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 9-[(2R,5R)-5-azido-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136649956 |
| Molecular Formula | C10H11N7O5 |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 9-[(2R,5R)-5-azido-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | [N-]=[N+]=N[C@]1(CO)O[C@@H](n2cnc3c(=O)[nH]cnc32)C(O)C1O |
| InChI | InChI=1S/C10H11N7O5/c11-16-15-10(1-18)6(20)5(19)9(22-10)17-3-14-4-7(17)12-2-13-8(4)21/h2-3,5-6,9,18-20H,1H2,(H,12,13,21)/t5?,6?,9-,10-/m1/s1 |
| InChIKey | MERMDRROGGVGCD-KAFUYXJBSA-N |
| XLogP | -1.63 |
| TPSA | 182.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|