C13H13N5O4 — CID 136608504
9-[(2R,3S,4S,5R)-3-ethynyl-4-hydroxy-5-(hydroxymethyl)-5-(methylideneamino)oxolan-2-yl]-1H-purin-6-one (PubChem CID 136608504) has the molecular formula C13H13N5O4 and a molecular weight of 303.28 g/mol. Its IUPAC name is 9-[(2R,3S,4S,5R)-3-ethynyl-4-hydroxy-5-(hydroxymethyl)-5-(methylideneamino)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 9-[(2R,3S,4S,5R)-3-ethynyl-4-hydroxy-5-(hydroxymethyl)-5-(methylideneamino)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136608504 |
| Molecular Formula | C13H13N5O4 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 9-[(2R,3S,4S,5R)-3-ethynyl-4-hydroxy-5-(hydroxymethyl)-5-(methylideneamino)oxolan-2-yl]-1H-purin-6-one |
| SMILES | C#C[C@@H]1[C@H](n2cnc3c(=O)[nH]cnc32)O[C@@](CO)(N=C)[C@H]1O |
| InChI | InChI=1S/C13H13N5O4/c1-3-7-9(20)13(4-19,14-2)22-12(7)18-6-17-8-10(18)15-5-16-11(8)21/h1,5-7,9,12,19-20H,2,4H2,(H,15,16,21)/t7-,9-,12+,13+/m0/s1 |
| InChIKey | KWXLTHXGHYRIPD-LYDNSBFWSA-N |
| XLogP | -1.35 |
| TPSA | 125.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|